C13H24N2 — CID 145336020
(5E)-5-[(Z)-but-2-enylidene]-1-methyl-4-methylidenepyrazole;ethane (PubChem CID 145336020) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (5E)-5-[(Z)-but-2-enylidene]-1-methyl-4-methylidenepyrazole;ethane.
| Compound Name | (5E)-5-[(Z)-but-2-enylidene]-1-methyl-4-methylidenepyrazole;ethane |
|---|---|
| PubChem CID | 145336020 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (5E)-5-[(Z)-but-2-enylidene]-1-methyl-4-methylidenepyrazole;ethane |
| SMILES | C=c1cnn(C)/c1=C/C=C\C.CC.CC |
| InChI | InChI=1S/C9H12N2.2C2H6/c1-4-5-6-9-8(2)7-10-11(9)3;2*1-2/h4-7H,2H2,1,3H3;2*1-2H3/b5-4-,9-6+;; |
| InChIKey | YKDGGFAXNWGSKT-QJYMLJTBSA-N |
| XLogP | 2.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |