About 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane
5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane (PubChem CID 143829864) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane.
Analyze 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane?
The IUPAC name of 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane (CID 143829864) is 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane.
What is the SMILES notation for 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane?
The canonical SMILES for 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane is CC.CC(C)=c1ccccc1=C(C)C.
What is the InChIKey of 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane?
The InChIKey is ZONUKNQBFCMMRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C2H6/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2/h5-8H,1-4H3;1-2H3.
What are the key properties of 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane?
5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane has a molecular weight of 190.33 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(propan-2-ylidene)cyclohexa-1,3-diene;ethane is sourced from PubChem (CID 143829864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).