C14H16BrN3O4 — CID 143829940
7-[(4-bromo-2-nitroanilino)methyl]-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one (PubChem CID 143829940) has the molecular formula C14H16BrN3O4 and a molecular weight of 370.20 g/mol. Its IUPAC name is 7-[(4-bromo-2-nitroanilino)methyl]-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one.
| Compound Name | 7-[(4-bromo-2-nitroanilino)methyl]-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 143829940 |
| Molecular Formula | C14H16BrN3O4 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 7-[(4-bromo-2-nitroanilino)methyl]-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
| SMILES | O=C1COCC2CC(CNc3ccc(Br)cc3[N+](=O)[O-])CN12 |
| InChI | InChI=1S/C14H16BrN3O4/c15-10-1-2-12(13(4-10)18(20)21)16-5-9-3-11-7-22-8-14(19)17(11)6-9/h1-2,4,9,11,16H,3,5-8H2 |
| InChIKey | PFUBITXLDUKAMM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|