C13H16BrN3O3 — CID 58564430
(7R,8aR)-N-(4-bromo-2-nitrophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 58564430) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is (7R,8aR)-N-(4-bromo-2-nitrophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (7R,8aR)-N-(4-bromo-2-nitrophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 58564430 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (7R,8aR)-N-(4-bromo-2-nitrophenyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1N[C@@H]1C[C@@H]2COCCN2C1 |
| InChI | InChI=1S/C13H16BrN3O3/c14-9-1-2-12(13(5-9)17(18)19)15-10-6-11-8-20-4-3-16(11)7-10/h1-2,5,10-11,15H,3-4,6-8H2/t10-,11-/m1/s1 |
| InChIKey | HSJSQXHDZUUZOL-GHMZBOCLSA-N |
| XLogP | 2.24 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|