C28H31NO4S — CID 143830186
17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 143830186) has the molecular formula C28H31NO4S and a molecular weight of 477.63 g/mol. Its IUPAC name is 17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143830186 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)CSc3nc4ccccc4o3)CCC12 |
| InChI | InChI=1S/C28H31NO4S/c1-27-12-11-17(30)13-16(27)7-8-18-19-9-10-20(28(19,2)14-22(31)25(18)27)23(32)15-34-26-29-21-5-3-4-6-24(21)33-26/h3-6,11-13,18-20,22,25,31H,7-10,14-15H2,1-2H3 |
| InChIKey | CNSFFGJDGFUXBR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |