C39H60N4S — CID 143831388
4-[[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]-[4-[4-(6-methylideneoctyl)piperazin-1-yl]phenyl]methyl]-N,N-dimethylaniline;ethane;methanethiol (PubChem CID 143831388) has the molecular formula C39H60N4S and a molecular weight of 617.00 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]-[4-[4-(6-methylideneoctyl)piperazin-1-yl]phenyl]methyl]-N,N-dimethylaniline;ethane;methanethiol.
| Compound Name | 4-[[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]-[4-[4-(6-methylideneoctyl)piperazin-1-yl]phenyl]methyl]-N,N-dimethylaniline;ethane;methanethiol |
|---|---|
| PubChem CID | 143831388 |
| Molecular Formula | C39H60N4S |
| Molecular Weight | 617.00 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | 4-[[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]-[4-[4-(6-methylideneoctyl)piperazin-1-yl]phenyl]methyl]-N,N-dimethylaniline;ethane;methanethiol |
| SMILES | C=C(CC)CCCCCN1CCN(c2ccc(C(=C3C=CC(N(C)C)C=C3)c3ccc(N(C)C)cc3)cc2)CC1.CC.CS |
| InChI | InChI=1S/C36H50N4.C2H6.CH4S/c1-7-29(2)11-9-8-10-24-39-25-27-40(28-26-39)35-22-16-32(17-23-35)36(30-12-18-33(19-13-30)37(3)4)31-14-20-34(21-15-31)38(5)6;2*1-2/h12-23,33H,2,7-11,24-28H2,1,3-6H3;1-2H3;2H,1H3/b36-30-;; |
| InChIKey | SFMDKIOJXXNOJK-HVFZEETOSA-N |
| XLogP | 8.83 |
| TPSA | 12.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.00 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|