C33H45N4O2+ — CID 143831377
[4-[[4-(dimethylamino)phenyl]-[4-[4-(6-methoxy-6-oxohexyl)piperazin-1-yl]phenyl]methylidene]cyclohexa-2,5-dien-1-yl]-methylazanium (PubChem CID 143831377) has the molecular formula C33H45N4O2+ and a molecular weight of 529.75 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-[4-[4-(6-methoxy-6-oxohexyl)piperazin-1-yl]phenyl]methylidene]cyclohexa-2,5-dien-1-yl]-methylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-[4-[4-(6-methoxy-6-oxohexyl)piperazin-1-yl]phenyl]methylidene]cyclohexa-2,5-dien-1-yl]-methylazanium |
|---|---|
| PubChem CID | 143831377 |
| Molecular Formula | C33H45N4O2+ |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-[4-[4-(6-methoxy-6-oxohexyl)piperazin-1-yl]phenyl]methylidene]cyclohexa-2,5-dien-1-yl]-methylazanium |
| SMILES | C[NH2+]C1C=CC(=C(c2ccc(N(C)C)cc2)c2ccc(N3CCN(CCCCCC(=O)OC)CC3)cc2)C=C1 |
| InChI | InChI=1S/C33H44N4O2/c1-34-29-15-9-26(10-16-29)33(27-11-17-30(18-12-27)35(2)3)28-13-19-31(20-14-28)37-24-22-36(23-25-37)21-7-5-6-8-32(38)39-4/h9-20,29,34H,5-8,21-25H2,1-4H3/p+1/b33-26- |
| InChIKey | BTUVPBOTFXMPSC-MKFPQRGTSA-O |
| XLogP | 4.10 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|