C27H28F3NO — CID 143832906
3-naphthalen-2-yl-1-[(6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinolin-6-yl]butan-1-one (PubChem CID 143832906) has the molecular formula C27H28F3NO and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-naphthalen-2-yl-1-[(6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinolin-6-yl]butan-1-one.
| Compound Name | 3-naphthalen-2-yl-1-[(6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinolin-6-yl]butan-1-one |
|---|---|
| PubChem CID | 143832906 |
| Molecular Formula | C27H28F3NO |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-naphthalen-2-yl-1-[(6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinolin-6-yl]butan-1-one |
| SMILES | CC(CC(=O)[C@@H]1CCc2nc(C(C)(C)C(F)(F)F)ccc2C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H28F3NO/c1-17(19-9-8-18-6-4-5-7-20(18)15-19)14-24(32)22-10-12-23-21(16-22)11-13-25(31-23)26(2,3)27(28,29)30/h4-9,11,13,15,17,22H,10,12,14,16H2,1-3H3/t17?,22-/m1/s1 |
| InChIKey | OSXKFPLBJXAOOO-IVAFLUGOSA-N |
| XLogP | 6.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |