C24H28ClFN2O6 — CID 143833058
6-[(3Z,5E)-6-chloro-7-fluoroocta-3,5,7-trienyl]-1-(2-hydroxyethyl)-7-(4-methoxybutoxy)-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 143833058) has the molecular formula C24H28ClFN2O6 and a molecular weight of 494.95 g/mol. Its IUPAC name is 6-[(3Z,5E)-6-chloro-7-fluoroocta-3,5,7-trienyl]-1-(2-hydroxyethyl)-7-(4-methoxybutoxy)-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 6-[(3Z,5E)-6-chloro-7-fluoroocta-3,5,7-trienyl]-1-(2-hydroxyethyl)-7-(4-methoxybutoxy)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143833058 |
| Molecular Formula | C24H28ClFN2O6 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 6-[(3Z,5E)-6-chloro-7-fluoroocta-3,5,7-trienyl]-1-(2-hydroxyethyl)-7-(4-methoxybutoxy)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C=C(F)/C(Cl)=C\C=C/CCc1cc2c(=O)c(C(=O)O)cn(CCO)c2nc1OCCCCOC |
| InChI | InChI=1S/C24H28ClFN2O6/c1-16(26)20(25)9-5-3-4-8-17-14-18-21(30)19(24(31)32)15-28(10-11-29)22(18)27-23(17)34-13-7-6-12-33-2/h3,5,9,14-15,29H,1,4,6-8,10-13H2,2H3,(H,31,32)/b5-3-,20-9+ |
| InChIKey | WWOTVRBALKWXDY-LXILKSQISA-N |
| XLogP | 3.99 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|