C13H15F2NO2 — CID 143834759
(NE)-N-[3-[(3,4-difluorophenyl)methoxy]hex-5-enylidene]hydroxylamine (PubChem CID 143834759) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is (NE)-N-[3-[(3,4-difluorophenyl)methoxy]hex-5-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-[(3,4-difluorophenyl)methoxy]hex-5-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 143834759 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (NE)-N-[3-[(3,4-difluorophenyl)methoxy]hex-5-enylidene]hydroxylamine |
| SMILES | C=CCC(C/C=N/O)OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO2/c1-2-3-11(6-7-16-17)18-9-10-4-5-12(14)13(15)8-10/h2,4-5,7-8,11,17H,1,3,6,9H2/b16-7+ |
| InChIKey | MFTSLMLBFBIIEB-FRKPEAEDSA-N |
| XLogP | 3.28 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|