C20H19FN4S — CID 143834826
5-[3-[(4aR,7aR)-2-amino-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-7a-yl]-4-fluorophenyl]pyridine-3-carbonitrile (PubChem CID 143834826) has the molecular formula C20H19FN4S and a molecular weight of 366.47 g/mol. Its IUPAC name is 5-[3-[(4aR,7aR)-2-amino-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-7a-yl]-4-fluorophenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[(4aR,7aR)-2-amino-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-7a-yl]-4-fluorophenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143834826 |
| Molecular Formula | C20H19FN4S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 5-[3-[(4aR,7aR)-2-amino-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-7a-yl]-4-fluorophenyl]pyridine-3-carbonitrile |
| SMILES | C[C@@]12CCC[C@]1(c1cc(-c3cncc(C#N)c3)ccc1F)N=C(N)SC2 |
| InChI | InChI=1S/C20H19FN4S/c1-19-5-2-6-20(19,25-18(23)26-12-19)16-8-14(3-4-17(16)21)15-7-13(9-22)10-24-11-15/h3-4,7-8,10-11H,2,5-6,12H2,1H3,(H2,23,25)/t19-,20+/m0/s1 |
| InChIKey | YGSQXRHCAPLXEK-VQTJNVASSA-N |
| XLogP | 4.21 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |