C14H14N6O3 — CID 143835174
6-[(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)amino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 143835174) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is 6-[(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)amino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 143835174 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 6-[(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCOc1nc(C)nc(Nc2ccc3[nH]c(=O)c(=O)[nH]c3c2)n1 |
| InChI | InChI=1S/C14H14N6O3/c1-3-23-14-16-7(2)15-13(20-14)17-8-4-5-9-10(6-8)19-12(22)11(21)18-9/h4-6H,3H2,1-2H3,(H,18,21)(H,19,22)(H,15,16,17,20) |
| InChIKey | ZCORMQDTJPXHIP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|