C13H11NS — CID 143836856
2-[4-[(1Z)-buta-1,3-dienyl]thiophen-2-yl]pyridine (PubChem CID 143836856) has the molecular formula C13H11NS and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-[4-[(1Z)-buta-1,3-dienyl]thiophen-2-yl]pyridine.
| Compound Name | 2-[4-[(1Z)-buta-1,3-dienyl]thiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 143836856 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-[4-[(1Z)-buta-1,3-dienyl]thiophen-2-yl]pyridine |
| SMILES | C=C/C=C\c1csc(-c2ccccn2)c1 |
| InChI | InChI=1S/C13H11NS/c1-2-3-6-11-9-13(15-10-11)12-7-4-5-8-14-12/h2-10H,1H2/b6-3- |
| InChIKey | ZHKISAFBXXWLIS-UTCJRWHESA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|