C18H23N — CID 145134911
2-[6-[(1Z)-buta-1,3-dienyl]-5-methylcyclohexa-1,5-dien-1-yl]pyridine;ethane (PubChem CID 145134911) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-[6-[(1Z)-buta-1,3-dienyl]-5-methylcyclohexa-1,5-dien-1-yl]pyridine;ethane.
| Compound Name | 2-[6-[(1Z)-buta-1,3-dienyl]-5-methylcyclohexa-1,5-dien-1-yl]pyridine;ethane |
|---|---|
| PubChem CID | 145134911 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[6-[(1Z)-buta-1,3-dienyl]-5-methylcyclohexa-1,5-dien-1-yl]pyridine;ethane |
| SMILES | C=C/C=C\C1=C(C)CCC=C1c1ccccn1.CC |
| InChI | InChI=1S/C16H17N.C2H6/c1-3-4-9-14-13(2)8-7-10-15(14)16-11-5-6-12-17-16;1-2/h3-6,9-12H,1,7-8H2,2H3;1-2H3/b9-4-; |
| InChIKey | RAFPREVYTWCYMV-WONROIIJSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|