C9H11NS — CID 143838546
6-[(1Z)-2-methylbuta-1,3-dienyl]-2H-1,4-thiazine (PubChem CID 143838546) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 6-[(1Z)-2-methylbuta-1,3-dienyl]-2H-1,4-thiazine.
| Compound Name | 6-[(1Z)-2-methylbuta-1,3-dienyl]-2H-1,4-thiazine |
|---|---|
| PubChem CID | 143838546 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-[(1Z)-2-methylbuta-1,3-dienyl]-2H-1,4-thiazine |
| SMILES | C=C/C(C)=C\C1=CN=CCS1 |
| InChI | InChI=1S/C9H11NS/c1-3-8(2)6-9-7-10-4-5-11-9/h3-4,6-7H,1,5H2,2H3/b8-6- |
| InChIKey | OSKZCDQEHMFGIO-VURMDHGXSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|