C12H21NS — CID 142809559
N-[(1Z,3E)-3-methyl-2-methylsulfanylpenta-1,3-dienyl]ethanimine;prop-1-ene (PubChem CID 142809559) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is N-[(1Z,3E)-3-methyl-2-methylsulfanylpenta-1,3-dienyl]ethanimine;prop-1-ene.
| Compound Name | N-[(1Z,3E)-3-methyl-2-methylsulfanylpenta-1,3-dienyl]ethanimine;prop-1-ene |
|---|---|
| PubChem CID | 142809559 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-[(1Z,3E)-3-methyl-2-methylsulfanylpenta-1,3-dienyl]ethanimine;prop-1-ene |
| SMILES | C/C=N/C=C(SC)/C(C)=C/C.C=CC |
| InChI | InChI=1S/C9H15NS.C3H6/c1-5-8(3)9(11-4)7-10-6-2;1-3-2/h5-7H,1-4H3;3H,1H2,2H3/b8-5+,9-7-,10-6+; |
| InChIKey | YWRNQJCJLULFEI-DYJRPBTHSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|