C12H19NS — CID 145259339
N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2-methylsulfanylbutan-1-imine (PubChem CID 145259339) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2-methylsulfanylbutan-1-imine.
| Compound Name | N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2-methylsulfanylbutan-1-imine |
|---|---|
| PubChem CID | 145259339 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2-methylsulfanylbutan-1-imine |
| SMILES | C=C/C(C)=C(C=C)/N=C/C(CC)SC |
| InChI | InChI=1S/C12H19NS/c1-6-10(4)12(8-3)13-9-11(7-2)14-5/h6,8-9,11H,1,3,7H2,2,4-5H3/b12-10+,13-9+ |
| InChIKey | PNNIZMDRLCSXQD-DSEBWEOJSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|