C14H19NO4 — CID 143838692
1-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]carbonylpyrrolidine-2-carboxylic acid (PubChem CID 143838692) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]carbonylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]carbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 143838692 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]carbonylpyrrolidine-2-carboxylic acid |
| SMILES | C=C/C=C\C=C(/C)COC(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-3-4-5-7-11(2)10-19-14(18)15-9-6-8-12(15)13(16)17/h3-5,7,12H,1,6,8-10H2,2H3,(H,16,17)/b5-4-,11-7+ |
| InChIKey | WKJAHSOPOPVYPJ-DNFZQOLXSA-N |
| XLogP | 2.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|