C17H34N2 — CID 143841173
ethane;(Z)-N-[(E)-2-piperidin-4-ylprop-1-enyl]pent-3-en-2-imine (PubChem CID 143841173) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;(Z)-N-[(E)-2-piperidin-4-ylprop-1-enyl]pent-3-en-2-imine.
| Compound Name | ethane;(Z)-N-[(E)-2-piperidin-4-ylprop-1-enyl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 143841173 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;(Z)-N-[(E)-2-piperidin-4-ylprop-1-enyl]pent-3-en-2-imine |
| SMILES | C/C=C\C(C)=N\C=C(/C)C1CCNCC1.CC.CC |
| InChI | InChI=1S/C13H22N2.2C2H6/c1-4-5-12(3)15-10-11(2)13-6-8-14-9-7-13;2*1-2/h4-5,10,13-14H,6-9H2,1-3H3;2*1-2H3/b5-4-,11-10+,15-12+;; |
| InChIKey | ZKSNXVQJEITTAG-NDBNLOFLSA-N |
| XLogP | 4.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|