C30H36N4O — CID 143841253
6-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]-8-[4-(1-propan-2-ylpiperidin-4-yl)anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 143841253) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 6-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]-8-[4-(1-propan-2-ylpiperidin-4-yl)anilino]-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]-8-[4-(1-propan-2-ylpiperidin-4-yl)anilino]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 143841253 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 6-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]-8-[4-(1-propan-2-ylpiperidin-4-yl)anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | C=C(C)/C=C\C=C(/C)c1cc2cc[nH]c(=O)c2c(Nc2ccc(C3CCN(C(C)C)CC3)cc2)n1 |
| InChI | InChI=1S/C30H36N4O/c1-20(2)7-6-8-22(5)27-19-25-13-16-31-30(35)28(25)29(33-27)32-26-11-9-23(10-12-26)24-14-17-34(18-15-24)21(3)4/h6-13,16,19,21,24H,1,14-15,17-18H2,2-5H3,(H,31,35)(H,32,33)/b7-6-,22-8+ |
| InChIKey | HVCXTJCKRJIDTI-PKRQGZDISA-N |
| XLogP | 6.79 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|