C14H19N3O3 — CID 143841802
N-spiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-ylacetohydrazide (PubChem CID 143841802) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-spiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-ylacetohydrazide.
| Compound Name | N-spiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-ylacetohydrazide |
|---|---|
| PubChem CID | 143841802 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-spiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-ylacetohydrazide |
| SMILES | CC(=O)N(N)c1ccc2c(c1)COC1(CCNCC1)O2 |
| InChI | InChI=1S/C14H19N3O3/c1-10(18)17(15)12-2-3-13-11(8-12)9-19-14(20-13)4-6-16-7-5-14/h2-3,8,16H,4-7,9,15H2,1H3 |
| InChIKey | FLKXPFWJHHYIIT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|