C12H15NO2 — CID 10845905
spiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 10845905) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is spiro[4H-1,3-benzodioxine-2,4'-piperidine].
| Compound Name | spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
|---|---|
| PubChem CID | 10845905 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | c1ccc2c(c1)COC1(CCNCC1)O2 |
| InChI | InChI=1S/C12H15NO2/c1-2-4-11-10(3-1)9-14-12(15-11)5-7-13-8-6-12/h1-4,13H,5-9H2 |
| InChIKey | FRNANTVJJKQZID-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |