About spiro[4H-1,3-benzodioxine-2,4'-piperidine]
spiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 10845905) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is spiro[4H-1,3-benzodioxine-2,4'-piperidine].
Molecular Properties
| Compound Name | spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| PubChem CID | 10845905 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | spiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | c1ccc2c(c1)COC1(CCNCC1)O2 |
| InChI | InChI=1S/C12H15NO2/c1-2-4-11-10(3-1)9-14-12(15-11)5-7-13-8-6-12/h1-4,13H,5-9H2 |
| InChIKey | FRNANTVJJKQZID-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[4H-1,3-benzodioxine-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The IUPAC name of spiro[4H-1,3-benzodioxine-2,4'-piperidine] (CID 10845905) is spiro[4H-1,3-benzodioxine-2,4'-piperidine].
What is the SMILES notation for spiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The canonical SMILES for spiro[4H-1,3-benzodioxine-2,4'-piperidine] is c1ccc2c(c1)COC1(CCNCC1)O2.
What is the InChIKey of spiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The InChIKey is FRNANTVJJKQZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-4-11-10(3-1)9-14-12(15-11)5-7-13-8-6-12/h1-4,13H,5-9H2.
What are the key properties of spiro[4H-1,3-benzodioxine-2,4'-piperidine]?
spiro[4H-1,3-benzodioxine-2,4'-piperidine] has a molecular weight of 205.26 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4H-1,3-benzodioxine-2,4'-piperidine] is sourced from PubChem (CID 10845905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).