C18H24N2O6 — CID 143842136
tert-butyl 2-[(1,3-dioxo-4,5-dihydroisoindol-2-yl)oxymethyl]morpholine-4-carboxylate (PubChem CID 143842136) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is tert-butyl 2-[(1,3-dioxo-4,5-dihydroisoindol-2-yl)oxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(1,3-dioxo-4,5-dihydroisoindol-2-yl)oxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 143842136 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | tert-butyl 2-[(1,3-dioxo-4,5-dihydroisoindol-2-yl)oxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(CON2C(=O)C3=C(CCC=C3)C2=O)C1 |
| InChI | InChI=1S/C18H24N2O6/c1-18(2,3)26-17(23)19-8-9-24-12(10-19)11-25-20-15(21)13-6-4-5-7-14(13)16(20)22/h4,6,12H,5,7-11H2,1-3H3 |
| InChIKey | CSLOWQPTEKIVSZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|