C30H29F4N3O3 — CID 143842978
(Z)-5-[3-[[4-fluoro-2-(4-methylbenzoyl)phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]pent-3-enenitrile;2-(trifluoromethyl)buta-1,3-diene (PubChem CID 143842978) has the molecular formula C30H29F4N3O3 and a molecular weight of 555.57 g/mol. Its IUPAC name is (Z)-5-[3-[[4-fluoro-2-(4-methylbenzoyl)phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]pent-3-enenitrile;2-(trifluoromethyl)buta-1,3-diene.
| Compound Name | (Z)-5-[3-[[4-fluoro-2-(4-methylbenzoyl)phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]pent-3-enenitrile;2-(trifluoromethyl)buta-1,3-diene |
|---|---|
| PubChem CID | 143842978 |
| Molecular Formula | C30H29F4N3O3 |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (Z)-5-[3-[[4-fluoro-2-(4-methylbenzoyl)phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]pent-3-enenitrile;2-(trifluoromethyl)buta-1,3-diene |
| SMILES | C=CC(=C)C(F)(F)F.Cc1ccc(C(=O)c2cc(F)ccc2CN2C(=O)N(C/C=C\CC#N)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C25H24FN3O3.C5H5F3/c1-17-7-9-18(10-8-17)22(30)21-15-20(26)12-11-19(21)16-29-24(32)28(14-6-4-5-13-27)23(31)25(29,2)3;1-3-4(2)5(6,7)8/h4,6-12,15H,5,14,16H2,1-3H3;3H,1-2H2/b6-4-; |
| InChIKey | XSSFTPJUEGUFGH-YHSAGPEESA-N |
| XLogP | 6.67 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|