About 3-methylfuran-2-carbonyl iodide
3-methylfuran-2-carbonyl iodide (PubChem CID 143843611) has the molecular formula C6H5IO2
and a molecular weight of 236.01 g/mol. Its IUPAC name is 3-methylfuran-2-carbonyl iodide.
Molecular Properties
| Compound Name | 3-methylfuran-2-carbonyl iodide |
| PubChem CID | 143843611 |
| Molecular Formula | C6H5IO2 |
| Molecular Weight | 236.01 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 3-methylfuran-2-carbonyl iodide |
| SMILES | Cc1ccoc1C(=O)I |
| InChI | InChI=1S/C6H5IO2/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| InChIKey | ALIKYHQOMYOSCY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.01 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-methylfuran-2-carbonyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylfuran-2-carbonyl iodide?
The IUPAC name of 3-methylfuran-2-carbonyl iodide (CID 143843611) is 3-methylfuran-2-carbonyl iodide.
What is the SMILES notation for 3-methylfuran-2-carbonyl iodide?
The canonical SMILES for 3-methylfuran-2-carbonyl iodide is Cc1ccoc1C(=O)I.
What is the InChIKey of 3-methylfuran-2-carbonyl iodide?
The InChIKey is ALIKYHQOMYOSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IO2/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3.
What are the key properties of 3-methylfuran-2-carbonyl iodide?
3-methylfuran-2-carbonyl iodide has a molecular weight of 236.01 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylfuran-2-carbonyl iodide is sourced from PubChem (CID 143843611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).