C15H16O2 — CID 43462607
(3-methylfuran-2-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 43462607) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (3-methylfuran-2-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 43462607 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (3-methylfuran-2-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2occc2C)c(C)c1 |
| InChI | InChI=1S/C15H16O2/c1-9-7-11(3)13(12(4)8-9)14(16)15-10(2)5-6-17-15/h5-8H,1-4H3 |
| InChIKey | RAAQLROQJCJYQR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |