C26H34BrNO4 — CID 143844113
1-[5-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2-methoxyphenyl]ethanone (PubChem CID 143844113) has the molecular formula C26H34BrNO4 and a molecular weight of 504.47 g/mol. Its IUPAC name is 1-[5-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2-methoxyphenyl]ethanone.
| Compound Name | 1-[5-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 143844113 |
| Molecular Formula | C26H34BrNO4 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 1-[5-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2-methoxyphenyl]ethanone |
| SMILES | COCCOc1cc(CC2CCN(CCc3ccc(OC)c(C(C)=O)c3)CC2)ccc1Br |
| InChI | InChI=1S/C26H34BrNO4/c1-19(29)23-17-20(5-7-25(23)31-3)8-11-28-12-9-21(10-13-28)16-22-4-6-24(27)26(18-22)32-15-14-30-2/h4-7,17-18,21H,8-16H2,1-3H3 |
| InChIKey | CZWVBRCFOVKPBH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|