C34H44BrNO12 — CID 161414040
6-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2,3-dihydrochromen-4-one;bis(butanedioic acid) (PubChem CID 161414040) has the molecular formula C34H44BrNO12 and a molecular weight of 738.62 g/mol. Its IUPAC name is 6-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2,3-dihydrochromen-4-one;bis(butanedioic acid).
| Compound Name | 6-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2,3-dihydrochromen-4-one;bis(butanedioic acid) |
|---|---|
| PubChem CID | 161414040 |
| Molecular Formula | C34H44BrNO12 |
| Molecular Weight | 738.62 g/mol |
| Exact Mass | 737.20 |
| IUPAC Name | 6-[2-[4-[[4-bromo-3-(2-methoxyethoxy)phenyl]methyl]piperidin-1-yl]ethyl]-2,3-dihydrochromen-4-one;bis(butanedioic acid) |
| SMILES | COCCOc1cc(CC2CCN(CCc3ccc4c(c3)C(=O)CCO4)CC2)ccc1Br.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C26H32BrNO4.2C4H6O4/c1-30-14-15-32-26-18-21(2-4-23(26)27)16-20-7-11-28(12-8-20)10-6-19-3-5-25-22(17-19)24(29)9-13-31-25;2*5-3(6)1-2-4(7)8/h2-5,17-18,20H,6-16H2,1H3;2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | VVVOFGZELOEOPN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|