C17H17IN2OS — CID 143844716
4-(4-iodo-6-methoxy-8-methylquinolin-2-yl)-2-propan-2-yl-1,3-thiazole (PubChem CID 143844716) has the molecular formula C17H17IN2OS and a molecular weight of 424.31 g/mol. Its IUPAC name is 4-(4-iodo-6-methoxy-8-methylquinolin-2-yl)-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-(4-iodo-6-methoxy-8-methylquinolin-2-yl)-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 143844716 |
| Molecular Formula | C17H17IN2OS |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 4-(4-iodo-6-methoxy-8-methylquinolin-2-yl)-2-propan-2-yl-1,3-thiazole |
| SMILES | COc1cc(C)c2nc(-c3csc(C(C)C)n3)cc(I)c2c1 |
| InChI | InChI=1S/C17H17IN2OS/c1-9(2)17-20-15(8-22-17)14-7-13(18)12-6-11(21-4)5-10(3)16(12)19-14/h5-9H,1-4H3 |
| InChIKey | JIGKAQNDYMKQHO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|