C17H39N5 — CID 143845115
diazene;ethane;(Z)-1-N-(methylideneamino)-1-N-(4-methylpentyl)oct-1-ene-1,2-diamine (PubChem CID 143845115) has the molecular formula C17H39N5 and a molecular weight of 313.53 g/mol. Its IUPAC name is diazene;ethane;(Z)-1-N-(methylideneamino)-1-N-(4-methylpentyl)oct-1-ene-1,2-diamine.
| Compound Name | diazene;ethane;(Z)-1-N-(methylideneamino)-1-N-(4-methylpentyl)oct-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 143845115 |
| Molecular Formula | C17H39N5 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.32 |
| IUPAC Name | diazene;ethane;(Z)-1-N-(methylideneamino)-1-N-(4-methylpentyl)oct-1-ene-1,2-diamine |
| SMILES | C=NN(/C=C(\N)CCCCCC)CCCC(C)C.CC.[H]/N=N/[H] |
| InChI | InChI=1S/C15H31N3.C2H6.H2N2/c1-5-6-7-8-11-15(16)13-18(17-4)12-9-10-14(2)3;2*1-2/h13-14H,4-12,16H2,1-3H3;1-2H3;1-2H/b15-13-;;2-1+ |
| InChIKey | IAKUBDDQZDGRNL-NHTVAOIBSA-N |
| XLogP | 5.73 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|