C27H28N6O3S — CID 143846403
[N-[2-[5-[4-(dimethylcarbamoyl)phenyl]-13-methyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate (PubChem CID 143846403) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is [N-[2-[5-[4-(dimethylcarbamoyl)phenyl]-13-methyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate.
| Compound Name | [N-[2-[5-[4-(dimethylcarbamoyl)phenyl]-13-methyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate |
|---|---|
| PubChem CID | 143846403 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [N-[2-[5-[4-(dimethylcarbamoyl)phenyl]-13-methyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]-2-methylpropanoyl]carbamimidoyl] methanimidothioate |
| SMILES | [H]/N=C(/NC(=O)C(C)(C)C1c2ccc(C)nc2Oc2nc(-c3ccc(C(=O)N(C)C)cc3)ccc21)S/C=N/[H] |
| InChI | InChI=1S/C27H28N6O3S/c1-15-6-11-18-21(27(2,3)25(35)32-26(29)37-14-28)19-12-13-20(31-23(19)36-22(18)30-15)16-7-9-17(10-8-16)24(34)33(4)5/h6-14,21,28H,1-5H3,(H2,29,32,35)/b28-14+ |
| InChIKey | KKIKODOZKUWNQZ-CCVNUDIWSA-N |
| XLogP | 4.81 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|