C26H24N6O3S — CID 163952676
methanimidoyl 5-[4-(dimethylcarbamoyl)phenyl]-16,16-dimethyl-15-oxo-8-oxa-6,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-14-carboximidothioate (PubChem CID 163952676) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is methanimidoyl 5-[4-(dimethylcarbamoyl)phenyl]-16,16-dimethyl-15-oxo-8-oxa-6,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-14-carboximidothioate.
| Compound Name | methanimidoyl 5-[4-(dimethylcarbamoyl)phenyl]-16,16-dimethyl-15-oxo-8-oxa-6,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-14-carboximidothioate |
|---|---|
| PubChem CID | 163952676 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methanimidoyl 5-[4-(dimethylcarbamoyl)phenyl]-16,16-dimethyl-15-oxo-8-oxa-6,10,14-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-14-carboximidothioate |
| SMILES | [H]/N=C(\S/C=N/[H])N1C(=O)C(C)(C)C2c3ccc(-c4ccc(C(=O)N(C)C)cc4)nc3Oc3nccc1c32 |
| InChI | InChI=1S/C26H24N6O3S/c1-26(2)20-16-9-10-17(14-5-7-15(8-6-14)23(33)31(3)4)30-21(16)35-22-19(20)18(11-12-29-22)32(24(26)34)25(28)36-13-27/h5-13,20,27-28H,1-4H3/b27-13+,28-25- |
| InChIKey | SAROOJFYEGEKML-UZDSLJDTSA-N |
| XLogP | 4.73 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|