C23H18ClN3O4 — CID 88983625
2-[5-chloro-13-[4-(dimethylcarbamoyl)phenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]prop-2-enoic acid (PubChem CID 88983625) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 2-[5-chloro-13-[4-(dimethylcarbamoyl)phenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]prop-2-enoic acid.
| Compound Name | 2-[5-chloro-13-[4-(dimethylcarbamoyl)phenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 88983625 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[5-chloro-13-[4-(dimethylcarbamoyl)phenyl]-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-9-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1c2ccc(Cl)nc2Oc2nc(-c3ccc(C(=O)N(C)C)cc3)ccc21 |
| InChI | InChI=1S/C23H18ClN3O4/c1-12(23(29)30)19-15-8-10-17(13-4-6-14(7-5-13)22(28)27(2)3)25-20(15)31-21-16(19)9-11-18(24)26-21/h4-11,19H,1H2,2-3H3,(H,29,30) |
| InChIKey | LQNRSRURFTXELY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|