C7H10FN — CID 143847654
(3E)-3-fluoro-4-methylhexa-1,3,5-trien-2-amine (PubChem CID 143847654) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (3E)-3-fluoro-4-methylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-3-fluoro-4-methylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143847654 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (3E)-3-fluoro-4-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(C)=C(/F)C(=C)N |
| InChI | InChI=1S/C7H10FN/c1-4-5(2)7(8)6(3)9/h4H,1,3,9H2,2H3/b7-5+ |
| InChIKey | WFROIXHHDHQZFD-FNORWQNLSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|