About ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine
ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 143851802) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 143851802 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | CC.Cc1ccc(-c2ncn(C)n2)cn1 |
| InChI | InChI=1S/C9H10N4.C2H6/c1-7-3-4-8(5-10-7)9-11-6-13(2)12-9;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | WOEXKSITEOTFAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine (CID 143851802) is ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine is CC.Cc1ccc(-c2ncn(C)n2)cn1.
What is the InChIKey of ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine?
The InChIKey is WOEXKSITEOTFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4.C2H6/c1-7-3-4-8(5-10-7)9-11-6-13(2)12-9;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine?
ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine has a molecular weight of 204.28 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 143851802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).