C16H16O4S — CID 14385182
(2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxirane (PubChem CID 14385182) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is (2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxirane.
| Compound Name | (2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 14385182 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (2R,3R)-2-(benzenesulfonyl)-3-(phenylmethoxymethyl)oxirane |
| SMILES | O=S(=O)(c1ccccc1)[C@H]1O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C16H16O4S/c17-21(18,14-9-5-2-6-10-14)16-15(20-16)12-19-11-13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16-/m1/s1 |
| InChIKey | YBZZPLBDYSEAAC-HZPDHXFCSA-N |
| XLogP | 2.40 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|