C7H3BrFN3OS — CID 143854039
(2-bromo-7-formylpyrrolo[2,3-b]pyrazin-5-yl) thiohypofluorite (PubChem CID 143854039) has the molecular formula C7H3BrFN3OS and a molecular weight of 276.09 g/mol. Its IUPAC name is (2-bromo-7-formylpyrrolo[2,3-b]pyrazin-5-yl) thiohypofluorite.
| Compound Name | (2-bromo-7-formylpyrrolo[2,3-b]pyrazin-5-yl) thiohypofluorite |
|---|---|
| PubChem CID | 143854039 |
| Molecular Formula | C7H3BrFN3OS |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.92 |
| IUPAC Name | (2-bromo-7-formylpyrrolo[2,3-b]pyrazin-5-yl) thiohypofluorite |
| SMILES | O=Cc1cn(SF)c2ncc(Br)nc12 |
| InChI | InChI=1S/C7H3BrFN3OS/c8-5-1-10-7-6(11-5)4(3-13)2-12(7)14-9/h1-3H |
| InChIKey | WPEGTHMTVHSODN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|