C9H15F2N — CID 143857248
(Z)-1,1-difluoro-N,5,5-trimethylhex-3-en-2-imine (PubChem CID 143857248) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is (Z)-1,1-difluoro-N,5,5-trimethylhex-3-en-2-imine.
| Compound Name | (Z)-1,1-difluoro-N,5,5-trimethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 143857248 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (Z)-1,1-difluoro-N,5,5-trimethylhex-3-en-2-imine |
| SMILES | C/N=C(/C=C\C(C)(C)C)C(F)F |
| InChI | InChI=1S/C9H15F2N/c1-9(2,3)6-5-7(12-4)8(10)11/h5-6,8H,1-4H3/b6-5-,12-7- |
| InChIKey | PKXHBZCKCSDMQT-VZVVJSHISA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|