C14H18N2O — CID 143857789
3,7-dimethyl-4H-imidazo[5,1-c][1,4]benzoxazine;ethane (PubChem CID 143857789) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3,7-dimethyl-4H-imidazo[5,1-c][1,4]benzoxazine;ethane.
| Compound Name | 3,7-dimethyl-4H-imidazo[5,1-c][1,4]benzoxazine;ethane |
|---|---|
| PubChem CID | 143857789 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3,7-dimethyl-4H-imidazo[5,1-c][1,4]benzoxazine;ethane |
| SMILES | CC.Cc1ccc2c(c1)OCc1c(C)ncn1-2 |
| InChI | InChI=1S/C12H12N2O.C2H6/c1-8-3-4-10-12(5-8)15-6-11-9(2)13-7-14(10)11;1-2/h3-5,7H,6H2,1-2H3;1-2H3 |
| InChIKey | SPJXZPGSIHPMIR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |