C15H16O4 — CID 143859056
(E)-3-(1,3-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enoic acid (PubChem CID 143859056) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (E)-3-(1,3-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1,3-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 143859056 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-3-(1,3-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enoic acid |
| SMILES | COC1=C(/C=C/C(=O)O)C(OC)Cc2ccccc21 |
| InChI | InChI=1S/C15H16O4/c1-18-13-9-10-5-3-4-6-11(10)15(19-2)12(13)7-8-14(16)17/h3-8,13H,9H2,1-2H3,(H,16,17)/b8-7+ |
| InChIKey | LQTXPMZZMADBSD-BQYQJAHWSA-N |
| XLogP | 2.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|