C25H32N2O6 — CID 143860783
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;2-(3-methoxyphenoxy)-N-methylbenzamide (PubChem CID 143860783) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;2-(3-methoxyphenoxy)-N-methylbenzamide.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;2-(3-methoxyphenoxy)-N-methylbenzamide |
|---|---|
| PubChem CID | 143860783 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;2-(3-methoxyphenoxy)-N-methylbenzamide |
| SMILES | C1CC2OCCC2O1.CNC(=O)c1ccccc1Oc1cccc(OC)c1.NC(=O)C1CC1 |
| InChI | InChI=1S/C15H15NO3.C6H10O2.C4H7NO/c1-16-15(17)13-8-3-4-9-14(13)19-12-7-5-6-11(10-12)18-2;1-3-7-6-2-4-8-5(1)6;5-4(6)3-1-2-3/h3-10H,1-2H3,(H,16,17);5-6H,1-4H2;3H,1-2H2,(H2,5,6) |
| InChIKey | FRVXCOCDWWXDMQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |