C16H11N3O2S — CID 143862090
3-(5-hydroxy-2H-1,2,3-benzothiadiazin-4-yl)-1H-quinolin-2-one (PubChem CID 143862090) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-(5-hydroxy-2H-1,2,3-benzothiadiazin-4-yl)-1H-quinolin-2-one.
| Compound Name | 3-(5-hydroxy-2H-1,2,3-benzothiadiazin-4-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 143862090 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-(5-hydroxy-2H-1,2,3-benzothiadiazin-4-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1C1=NNSc2cccc(O)c21 |
| InChI | InChI=1S/C16H11N3O2S/c20-12-6-3-7-13-14(12)15(18-19-22-13)10-8-9-4-1-2-5-11(9)17-16(10)21/h1-8,19-20H,(H,17,21) |
| InChIKey | MTEAEZACDQEICS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|