C46H30N6O — CID 170781189
3-[5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylpyrazin-2-yl]-1H-quinolin-2-one (PubChem CID 170781189) has the molecular formula C46H30N6O and a molecular weight of 682.79 g/mol. Its IUPAC name is 3-[5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylpyrazin-2-yl]-1H-quinolin-2-one.
| Compound Name | 3-[5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylpyrazin-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 170781189 |
| Molecular Formula | C46H30N6O |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | 3-[5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-diphenylpyrazin-2-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1nc(-c2ccccc2)c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C46H30N6O/c53-46-37(29-34-24-13-14-27-38(34)47-46)42-40(31-18-7-2-8-19-31)48-41(39(49-42)30-16-5-1-6-17-30)35-25-15-26-36(28-35)45-51-43(32-20-9-3-10-21-32)50-44(52-45)33-22-11-4-12-23-33/h1-29H,(H,47,53) |
| InChIKey | NJTHTYQUBQELSJ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |