C13H23NS — CID 143862264
3-cyclohexa-1,5-dien-1-yl-4-methylthiomorpholine;ethane (PubChem CID 143862264) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-4-methylthiomorpholine;ethane.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-4-methylthiomorpholine;ethane |
|---|---|
| PubChem CID | 143862264 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-4-methylthiomorpholine;ethane |
| SMILES | CC.CN1CCSCC1C1=CCCC=C1 |
| InChI | InChI=1S/C11H17NS.C2H6/c1-12-7-8-13-9-11(12)10-5-3-2-4-6-10;1-2/h3,5-6,11H,2,4,7-9H2,1H3;1-2H3 |
| InChIKey | OBIDAEFOZMWVBH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |