C10H15NS — CID 86158316
4-cyclohexa-2,4-dien-1-ylthiomorpholine (PubChem CID 86158316) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-ylthiomorpholine.
| Compound Name | 4-cyclohexa-2,4-dien-1-ylthiomorpholine |
|---|---|
| PubChem CID | 86158316 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-ylthiomorpholine |
| SMILES | C1=CCC(N2CCSCC2)C=C1 |
| InChI | InChI=1S/C10H15NS/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-4,10H,5-9H2 |
| InChIKey | JNGWJOMVYMKZLM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |