C13H22FNO6 — CID 143864219
fluoro 2-methyl-5-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]pentanoate (PubChem CID 143864219) has the molecular formula C13H22FNO6 and a molecular weight of 307.32 g/mol. Its IUPAC name is fluoro 2-methyl-5-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]pentanoate.
| Compound Name | fluoro 2-methyl-5-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]pentanoate |
|---|---|
| PubChem CID | 143864219 |
| Molecular Formula | C13H22FNO6 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | fluoro 2-methyl-5-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]pentanoate |
| SMILES | CC(=O)COCCOCCNC(=O)CCC(C)C(=O)OF |
| InChI | InChI=1S/C13H22FNO6/c1-10(13(18)21-14)3-4-12(17)15-5-6-19-7-8-20-9-11(2)16/h10H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | WULRVVXJSXJWDD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|