C13H25N2O4P — CID 143864284
(2S)-2-ethyl-5-oxo-5-[[6-oxo-5-(phosphanylamino)hexyl]amino]pentanoic acid (PubChem CID 143864284) has the molecular formula C13H25N2O4P and a molecular weight of 304.33 g/mol. Its IUPAC name is (2S)-2-ethyl-5-oxo-5-[[6-oxo-5-(phosphanylamino)hexyl]amino]pentanoic acid.
| Compound Name | (2S)-2-ethyl-5-oxo-5-[[6-oxo-5-(phosphanylamino)hexyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 143864284 |
| Molecular Formula | C13H25N2O4P |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2S)-2-ethyl-5-oxo-5-[[6-oxo-5-(phosphanylamino)hexyl]amino]pentanoic acid |
| SMILES | CC[C@@H](CCC(=O)NCCCCC(C=O)NP)C(=O)O |
| InChI | InChI=1S/C13H25N2O4P/c1-2-10(13(18)19)6-7-12(17)14-8-4-3-5-11(9-16)15-20/h9-11,15H,2-8,20H2,1H3,(H,14,17)(H,18,19)/t10-,11?/m0/s1 |
| InChIKey | RQQBKXRZFOEHDP-VUWPPUDQSA-N |
| XLogP | 1.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|