C22H36N2O8 — CID 158553566
5-[[1-carboxy-4-[(5-ethyl-6-oxoheptyl)amino]-4-oxobutyl]amino]-5-oxo-2-(2-oxopropyl)pentanoic acid (PubChem CID 158553566) has the molecular formula C22H36N2O8 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[[1-carboxy-4-[(5-ethyl-6-oxoheptyl)amino]-4-oxobutyl]amino]-5-oxo-2-(2-oxopropyl)pentanoic acid.
| Compound Name | 5-[[1-carboxy-4-[(5-ethyl-6-oxoheptyl)amino]-4-oxobutyl]amino]-5-oxo-2-(2-oxopropyl)pentanoic acid |
|---|---|
| PubChem CID | 158553566 |
| Molecular Formula | C22H36N2O8 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 5-[[1-carboxy-4-[(5-ethyl-6-oxoheptyl)amino]-4-oxobutyl]amino]-5-oxo-2-(2-oxopropyl)pentanoic acid |
| SMILES | CCC(CCCCNC(=O)CCC(NC(=O)CCC(CC(C)=O)C(=O)O)C(=O)O)C(C)=O |
| InChI | InChI=1S/C22H36N2O8/c1-4-16(15(3)26)7-5-6-12-23-19(27)11-9-18(22(31)32)24-20(28)10-8-17(21(29)30)13-14(2)25/h16-18H,4-13H2,1-3H3,(H,23,27)(H,24,28)(H,29,30)(H,31,32) |
| InChIKey | FIEIHVOSMPKYGM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|