C20H32ClN3O8 — CID 126757815
5-[[1-carboxy-4-[[5-(methylamino)-6-oxoheptyl]amino]-4-oxobutyl]amino]-2-(2-chloro-2-oxoethyl)-5-oxopentanoic acid (PubChem CID 126757815) has the molecular formula C20H32ClN3O8 and a molecular weight of 477.94 g/mol. Its IUPAC name is 5-[[1-carboxy-4-[[5-(methylamino)-6-oxoheptyl]amino]-4-oxobutyl]amino]-2-(2-chloro-2-oxoethyl)-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-4-[[5-(methylamino)-6-oxoheptyl]amino]-4-oxobutyl]amino]-2-(2-chloro-2-oxoethyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 126757815 |
| Molecular Formula | C20H32ClN3O8 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5-[[1-carboxy-4-[[5-(methylamino)-6-oxoheptyl]amino]-4-oxobutyl]amino]-2-(2-chloro-2-oxoethyl)-5-oxopentanoic acid |
| SMILES | CNC(CCCCNC(=O)CCC(NC(=O)CCC(CC(=O)Cl)C(=O)O)C(=O)O)C(C)=O |
| InChI | InChI=1S/C20H32ClN3O8/c1-12(25)14(22-2)5-3-4-10-23-17(27)9-7-15(20(31)32)24-18(28)8-6-13(19(29)30)11-16(21)26/h13-15,22H,3-11H2,1-2H3,(H,23,27)(H,24,28)(H,29,30)(H,31,32) |
| InChIKey | MNATWROSVWYPHG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 178.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|