C19H37N3NiO5-4 — CID 170732747
carbanide;(3R)-3-[[4-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-4-oxobutanoyl]amino]butanoic acid;nickel (PubChem CID 170732747) has the molecular formula C19H37N3NiO5-4 and a molecular weight of 446.21 g/mol. Its IUPAC name is carbanide;(3R)-3-[[4-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-4-oxobutanoyl]amino]butanoic acid;nickel.
| Compound Name | carbanide;(3R)-3-[[4-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-4-oxobutanoyl]amino]butanoic acid;nickel |
|---|---|
| PubChem CID | 170732747 |
| Molecular Formula | C19H37N3NiO5-4 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | carbanide;(3R)-3-[[4-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-4-oxobutanoyl]amino]butanoic acid;nickel |
| SMILES | [CH2-][C@H](CC(=O)O)NC(=O)CCC(=O)NCCCC[C@H](NC)C(C)=O.[CH3-].[CH3-].[CH3-].[Ni] |
| InChI | InChI=1S/C16H28N3O5.3CH3.Ni/c1-11(10-16(23)24)19-15(22)8-7-14(21)18-9-5-4-6-13(17-3)12(2)20;;;;/h11,13,17H,1,4-10H2,2-3H3,(H,18,21)(H,19,22)(H,23,24);3*1H3;/q4*-1;/t11-,13+;;;;/m1..../s1 |
| InChIKey | CKXWHCJBSADAHV-CJCXMGDZSA-N |
| XLogP | 1.37 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|